C9H7F3INO2S — CID 102474261
4-iodo-1-(trifluoromethylsulfonyl)-2,3-dihydroindole (PubChem CID 102474261) has the molecular formula C9H7F3INO2S and a molecular weight of 377.13 g/mol. Its IUPAC name is 4-iodo-1-(trifluoromethylsulfonyl)-2,3-dihydroindole.
| Compound Name | 4-iodo-1-(trifluoromethylsulfonyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 102474261 |
| Molecular Formula | C9H7F3INO2S |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 4-iodo-1-(trifluoromethylsulfonyl)-2,3-dihydroindole |
| SMILES | O=S(=O)(N1CCc2c(I)cccc21)C(F)(F)F |
| InChI | InChI=1S/C9H7F3INO2S/c10-9(11,12)17(15,16)14-5-4-6-7(13)2-1-3-8(6)14/h1-3H,4-5H2 |
| InChIKey | FFPUXYXAPIUVNB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|