C11H10F3NO2S — CID 102449182
1-(trifluoromethylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] (PubChem CID 102449182) has the molecular formula C11H10F3NO2S and a molecular weight of 277.27 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonyl)spiro[2H-indole-3,1'-cyclopropane].
| Compound Name | 1-(trifluoromethylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 102449182 |
| Molecular Formula | C11H10F3NO2S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 1-(trifluoromethylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] |
| SMILES | O=S(=O)(N1CC2(CC2)c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2S/c12-11(13,14)18(16,17)15-7-10(5-6-10)8-3-1-2-4-9(8)15/h1-4H,5-7H2 |
| InChIKey | CIFHXEGIERWGFE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |