C10H10ClN — CID 175936694
1-chlorospiro[2H-indole-3,1'-cyclopropane] (PubChem CID 175936694) has the molecular formula C10H10ClN and a molecular weight of 179.65 g/mol. Its IUPAC name is 1-chlorospiro[2H-indole-3,1'-cyclopropane].
| Compound Name | 1-chlorospiro[2H-indole-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 175936694 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 1-chlorospiro[2H-indole-3,1'-cyclopropane] |
| SMILES | ClN1CC2(CC2)c2ccccc21 |
| InChI | InChI=1S/C10H10ClN/c11-12-7-10(5-6-10)8-3-1-2-4-9(8)12/h1-4H,5-7H2 |
| InChIKey | JFBJDWNAVITFBS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|