C16H17FN2O2S — CID 110865660
N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 110865660) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 110865660 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1F)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H17FN2O2S/c17-15-9-3-1-7-14(15)12-18-22(20,21)19-11-5-8-13-6-2-4-10-16(13)19/h1-4,6-7,9-10,18H,5,8,11-12H2 |
| InChIKey | YFTZPICTUDLPAD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |