C17H18N2O3S — CID 110865860
N-(4-acetylphenyl)-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 110865860) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-(4-acetylphenyl)-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | N-(4-acetylphenyl)-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 110865860 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(4-acetylphenyl)-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-13(20)14-8-10-16(11-9-14)18-23(21,22)19-12-4-6-15-5-2-3-7-17(15)19/h2-3,5,7-11,18H,4,6,12H2,1H3 |
| InChIKey | VLCSBCGBYIRYGW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |