C16H14N2O3S — CID 91297351
1-(2,3-dihydroindol-1-ylsulfonyl)indol-2-ol (PubChem CID 91297351) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-ylsulfonyl)indol-2-ol.
| Compound Name | 1-(2,3-dihydroindol-1-ylsulfonyl)indol-2-ol |
|---|---|
| PubChem CID | 91297351 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(2,3-dihydroindol-1-ylsulfonyl)indol-2-ol |
| SMILES | O=S(=O)(N1CCc2ccccc21)n1c(O)cc2ccccc21 |
| InChI | InChI=1S/C16H14N2O3S/c19-16-11-13-6-2-4-8-15(13)18(16)22(20,21)17-10-9-12-5-1-3-7-14(12)17/h1-8,11,19H,9-10H2 |
| InChIKey | CPZYHPSCWRYHPR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |