C21H24N3O2S+ — CID 2315668
(3aS,7aR)-2-[3-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-3-ium (PubChem CID 2315668) has the molecular formula C21H24N3O2S+ and a molecular weight of 382.51 g/mol. Its IUPAC name is (3aS,7aR)-2-[3-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-3-ium.
| Compound Name | (3aS,7aR)-2-[3-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 2315668 |
| Molecular Formula | C21H24N3O2S+ |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (3aS,7aR)-2-[3-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-3-ium |
| SMILES | O=S(=O)(c1cccc(C2=[NH+][C@H]3CCCC[C@H]3N2)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H23N3O2S/c25-27(26,24-13-12-15-6-1-4-11-20(15)24)17-8-5-7-16(14-17)21-22-18-9-2-3-10-19(18)23-21/h1,4-8,11,14,18-19H,2-3,9-10,12-13H2,(H,22,23)/p+1/t18-,19+ |
| InChIKey | FBKLIRBXDODHCA-KDURUIRLSA-O |
| XLogP | 1.18 |
| TPSA | 63.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |