C18H17NO2 — CID 54723290
(5Z)-5-[hydroxy(phenyl)methylidene]-3-methyl-1,2-dihydro-3-benzazepin-4-one (PubChem CID 54723290) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (5Z)-5-[hydroxy(phenyl)methylidene]-3-methyl-1,2-dihydro-3-benzazepin-4-one.
| Compound Name | (5Z)-5-[hydroxy(phenyl)methylidene]-3-methyl-1,2-dihydro-3-benzazepin-4-one |
|---|---|
| PubChem CID | 54723290 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (5Z)-5-[hydroxy(phenyl)methylidene]-3-methyl-1,2-dihydro-3-benzazepin-4-one |
| SMILES | CN1CCc2ccccc2/C(=C(/O)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H17NO2/c1-19-12-11-13-7-5-6-10-15(13)16(18(19)21)17(20)14-8-3-2-4-9-14/h2-10,20H,11-12H2,1H3/b17-16- |
| InChIKey | TZUUNLLQZLRYQA-MSUUIHNZSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|