C16H22N4 — CID 22102285
2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 22102285) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 22102285 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| SMILES | c1ccc2c(c1)CCCC2C1N2CN3CN(C2)CN1C3 |
| InChI | InChI=1S/C16H22N4/c1-2-6-14-13(4-1)5-3-7-15(14)16-19-9-17-8-18(11-19)12-20(16)10-17/h1-2,4,6,15-16H,3,5,7-12H2 |
| InChIKey | NSCXTCNRESIPAH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |