C14H15NO — CID 15056816
1-(furan-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 15056816) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-(furan-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 15056816 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(furan-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2ccccc2C1c1ccco1 |
| InChI | InChI=1S/C14H15NO/c1-15-9-8-11-5-2-3-6-12(11)14(15)13-7-4-10-16-13/h2-7,10,14H,8-9H2,1H3 |
| InChIKey | QNHCKZMAGAEQNN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |