C9H11NO2 — CID 83826796
2-(furan-2-yl)-1-methylpyrrolidin-3-one (PubChem CID 83826796) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-methylpyrrolidin-3-one.
| Compound Name | 2-(furan-2-yl)-1-methylpyrrolidin-3-one |
|---|---|
| PubChem CID | 83826796 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-(furan-2-yl)-1-methylpyrrolidin-3-one |
| SMILES | CN1CCC(=O)C1c1ccco1 |
| InChI | InChI=1S/C9H11NO2/c1-10-5-4-7(11)9(10)8-3-2-6-12-8/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | SEIWVDIXZANMTL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |