C9H11NO3 — CID 15134388
3-(furan-2-yl)-4-methylmorpholin-2-one (PubChem CID 15134388) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-methylmorpholin-2-one.
| Compound Name | 3-(furan-2-yl)-4-methylmorpholin-2-one |
|---|---|
| PubChem CID | 15134388 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-(furan-2-yl)-4-methylmorpholin-2-one |
| SMILES | CN1CCOC(=O)C1c1ccco1 |
| InChI | InChI=1S/C9H11NO3/c1-10-4-6-13-9(11)8(10)7-3-2-5-12-7/h2-3,5,8H,4,6H2,1H3 |
| InChIKey | DOJLTFYJJOJVAF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |