C20H17NO2 — CID 11197439
(2R,5R)-5-(furan-2-yl)-1,2-diphenylpyrrolidin-3-one (PubChem CID 11197439) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2R,5R)-5-(furan-2-yl)-1,2-diphenylpyrrolidin-3-one.
| Compound Name | (2R,5R)-5-(furan-2-yl)-1,2-diphenylpyrrolidin-3-one |
|---|---|
| PubChem CID | 11197439 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (2R,5R)-5-(furan-2-yl)-1,2-diphenylpyrrolidin-3-one |
| SMILES | O=C1C[C@H](c2ccco2)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H17NO2/c22-18-14-17(19-12-7-13-23-19)21(16-10-5-2-6-11-16)20(18)15-8-3-1-4-9-15/h1-13,17,20H,14H2/t17-,20-/m1/s1 |
| InChIKey | CYTSKVGXKWEHCJ-YLJYHZDGSA-N |
| XLogP | 4.54 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |