C14H15NO3S — CID 20895729
1-(benzenesulfonyl)-2-(furan-2-yl)pyrrolidine (PubChem CID 20895729) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(furan-2-yl)pyrrolidine.
| Compound Name | 1-(benzenesulfonyl)-2-(furan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 20895729 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(furan-2-yl)pyrrolidine |
| SMILES | O=S(=O)(c1ccccc1)N1CCCC1c1ccco1 |
| InChI | InChI=1S/C14H15NO3S/c16-19(17,12-6-2-1-3-7-12)15-10-4-8-13(15)14-9-5-11-18-14/h1-3,5-7,9,11,13H,4,8,10H2 |
| InChIKey | YZGUQNHERBBJOP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |