C18H22N2O3S — CID 124865657
(2S)-2-(furan-2-yl)-1-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylpyrrolidine (PubChem CID 124865657) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-1-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylpyrrolidine.
| Compound Name | (2S)-2-(furan-2-yl)-1-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 124865657 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2S)-2-(furan-2-yl)-1-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylpyrrolidine |
| SMILES | O=S(=O)(N1CC[C@@H](c2ccccc2)C1)N1CCC[C@H]1c1ccco1 |
| InChI | InChI=1S/C18H22N2O3S/c21-24(22,20-11-4-8-17(20)18-9-5-13-23-18)19-12-10-16(14-19)15-6-2-1-3-7-15/h1-3,5-7,9,13,16-17H,4,8,10-12,14H2/t16-,17+/m1/s1 |
| InChIKey | AIWJZVBPKFZGPW-SJORKVTESA-N |
| XLogP | 3.15 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |