C13H17N3O4S — CID 96510950
(2S)-4-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonylmorpholine-2-carbonitrile (PubChem CID 96510950) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2S)-4-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonylmorpholine-2-carbonitrile.
| Compound Name | (2S)-4-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonylmorpholine-2-carbonitrile |
|---|---|
| PubChem CID | 96510950 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2S)-4-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonylmorpholine-2-carbonitrile |
| SMILES | N#C[C@@H]1CN(S(=O)(=O)N2CCC[C@H]2c2ccco2)CCO1 |
| InChI | InChI=1S/C13H17N3O4S/c14-9-11-10-15(6-8-19-11)21(17,18)16-5-1-3-12(16)13-4-2-7-20-13/h2,4,7,11-12H,1,3,5-6,8,10H2/t11-,12+/m1/s1 |
| InChIKey | JXFXSWPCGTYKSL-NEPJUHHUSA-N |
| XLogP | 0.89 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |