C13H19N3O4S — CID 97012816
1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-1,4-diazepan-5-one (PubChem CID 97012816) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 97012816 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)N2CCC[C@@H]2c2ccco2)CCN1 |
| InChI | InChI=1S/C13H19N3O4S/c17-13-5-8-15(9-6-14-13)21(18,19)16-7-1-3-11(16)12-4-2-10-20-12/h2,4,10-11H,1,3,5-9H2,(H,14,17)/t11-/m1/s1 |
| InChIKey | DXHPJFRABTVOGB-LLVKDONJSA-N |
| XLogP | 0.48 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |