C13H19N3O4S — CID 71929024
2-(furan-2-yl)-N-(6-oxopiperidin-3-yl)pyrrolidine-1-sulfonamide (PubChem CID 71929024) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-(6-oxopiperidin-3-yl)pyrrolidine-1-sulfonamide.
| Compound Name | 2-(furan-2-yl)-N-(6-oxopiperidin-3-yl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 71929024 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(furan-2-yl)-N-(6-oxopiperidin-3-yl)pyrrolidine-1-sulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)N2CCCC2c2ccco2)CN1 |
| InChI | InChI=1S/C13H19N3O4S/c17-13-6-5-10(9-14-13)15-21(18,19)16-7-1-3-11(16)12-4-2-8-20-12/h2,4,8,10-11,15H,1,3,5-7,9H2,(H,14,17) |
| InChIKey | XFSZJCBZJIQNNC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |