C11H21N3O3S — CID 62491451
3-methyl-N-(6-oxopiperidin-3-yl)piperidine-1-sulfonamide (PubChem CID 62491451) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 3-methyl-N-(6-oxopiperidin-3-yl)piperidine-1-sulfonamide.
| Compound Name | 3-methyl-N-(6-oxopiperidin-3-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 62491451 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-methyl-N-(6-oxopiperidin-3-yl)piperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)NC2CCC(=O)NC2)C1 |
| InChI | InChI=1S/C11H21N3O3S/c1-9-3-2-6-14(8-9)18(16,17)13-10-4-5-11(15)12-7-10/h9-10,13H,2-8H2,1H3,(H,12,15) |
| InChIKey | WAQNSTVTOXCVJE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |