C16H24N2O4S — CID 124729510
(5aS,8aR)-5-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine (PubChem CID 124729510) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is (5aS,8aR)-5-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine.
| Compound Name | (5aS,8aR)-5-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine |
|---|---|
| PubChem CID | 124729510 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (5aS,8aR)-5-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine |
| SMILES | O=S(=O)(N1CCC[C@@H]1c1ccco1)N1CCCO[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C16H24N2O4S/c19-23(20,17-9-2-6-14(17)16-8-3-11-21-16)18-10-4-12-22-15-7-1-5-13(15)18/h3,8,11,13-15H,1-2,4-7,9-10,12H2/t13-,14+,15+/m0/s1 |
| InChIKey | GDUPVFFKKLTRDU-RRFJBIMHSA-N |
| XLogP | 2.30 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |