C17H17F2NO5S — CID 167896052
2,3-difluoro-5-[2-(furan-2-yl)azepan-1-yl]sulfonylbenzoic acid (PubChem CID 167896052) has the molecular formula C17H17F2NO5S and a molecular weight of 385.39 g/mol. Its IUPAC name is 2,3-difluoro-5-[2-(furan-2-yl)azepan-1-yl]sulfonylbenzoic acid.
| Compound Name | 2,3-difluoro-5-[2-(furan-2-yl)azepan-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 167896052 |
| Molecular Formula | C17H17F2NO5S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2,3-difluoro-5-[2-(furan-2-yl)azepan-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCCCCC2c2ccco2)cc(F)c1F |
| InChI | InChI=1S/C17H17F2NO5S/c18-13-10-11(9-12(16(13)19)17(21)22)26(23,24)20-7-3-1-2-5-14(20)15-6-4-8-25-15/h4,6,8-10,14H,1-3,5,7H2,(H,21,22) |
| InChIKey | YSLSCUJYDWINGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |