C19H22FNO5S — CID 99823476
(2R)-1-[3-fluoro-4-(oxan-4-yloxy)phenyl]sulfonyl-2-(furan-2-yl)pyrrolidine (PubChem CID 99823476) has the molecular formula C19H22FNO5S and a molecular weight of 395.45 g/mol. Its IUPAC name is (2R)-1-[3-fluoro-4-(oxan-4-yloxy)phenyl]sulfonyl-2-(furan-2-yl)pyrrolidine.
| Compound Name | (2R)-1-[3-fluoro-4-(oxan-4-yloxy)phenyl]sulfonyl-2-(furan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 99823476 |
| Molecular Formula | C19H22FNO5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (2R)-1-[3-fluoro-4-(oxan-4-yloxy)phenyl]sulfonyl-2-(furan-2-yl)pyrrolidine |
| SMILES | O=S(=O)(c1ccc(OC2CCOCC2)c(F)c1)N1CCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C19H22FNO5S/c20-16-13-15(5-6-18(16)26-14-7-11-24-12-8-14)27(22,23)21-9-1-3-17(21)19-4-2-10-25-19/h2,4-6,10,13-14,17H,1,3,7-9,11-12H2/t17-/m1/s1 |
| InChIKey | KDLCPGLXIOKHOK-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |