C18H16N2O6S — CID 20895736
6-[2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 20895736) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 6-[2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-[2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 20895736 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 6-[2-(furan-2-yl)pyrrolidin-1-yl]sulfonyl-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccc(S(=O)(=O)N3CCCC3c3ccco3)cc2c1=O |
| InChI | InChI=1S/C18H16N2O6S/c21-17-12-9-11(5-6-14(12)19-10-13(17)18(22)23)27(24,25)20-7-1-3-15(20)16-4-2-8-26-16/h2,4-6,8-10,15H,1,3,7H2,(H,19,21)(H,22,23) |
| InChIKey | RYNMXSZMYGUUMD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |