C15H16ClNO4S — CID 51550831
(2R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-2-(furan-2-yl)pyrrolidine (PubChem CID 51550831) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is (2R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-2-(furan-2-yl)pyrrolidine.
| Compound Name | (2R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-2-(furan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 51550831 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (2R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-2-(furan-2-yl)pyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H]2c2ccco2)cc1Cl |
| InChI | InChI=1S/C15H16ClNO4S/c1-20-14-7-6-11(10-12(14)16)22(18,19)17-8-2-4-13(17)15-5-3-9-21-15/h3,5-7,9-10,13H,2,4,8H2,1H3/t13-/m1/s1 |
| InChIKey | HHVFCQZVCLPNJW-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |