C30H36O3 — CID 101436254
(E)-1-(2,4-dimethylphenyl)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]prop-2-en-1-one (PubChem CID 101436254) has the molecular formula C30H36O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is (E)-1-(2,4-dimethylphenyl)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethylphenyl)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 101436254 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (E)-1-(2,4-dimethylphenyl)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]prop-2-en-1-one |
| SMILES | COc1cc2c(cc1/C=C/C(=O)c1ccc(C)cc1C)[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C30H36O3/c1-18-5-8-22(19(2)15-18)27(31)11-7-21-16-25-20(17-28(21)33-4)6-9-24-23(25)13-14-30(3)26(24)10-12-29(30)32/h5,7-8,11,15-17,23-24,26,29,32H,6,9-10,12-14H2,1-4H3/b11-7+/t23-,24+,26-,29-,30-/m0/s1 |
| InChIKey | DRKXOXOWDNRNQF-BZCMKAPYSA-N |
| XLogP | 6.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|