C27H32O2 — CID 91374443
(8R,9S,13S,14S,17S)-3-ethenoxy-13-methyl-2-(3-methylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 91374443) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3-ethenoxy-13-methyl-2-(3-methylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-3-ethenoxy-13-methyl-2-(3-methylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 91374443 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3-ethenoxy-13-methyl-2-(3-methylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C=COc1cc2c(cc1-c1cccc(C)c1)[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C27H32O2/c1-4-29-25-15-19-8-9-21-20(12-13-27(3)24(21)10-11-26(27)28)22(19)16-23(25)18-7-5-6-17(2)14-18/h4-7,14-16,20-21,24,26,28H,1,8-13H2,2-3H3/t20-,21+,24-,26-,27-/m0/s1 |
| InChIKey | FLOGJXJOGHNOCZ-WRHIHAPESA-N |
| XLogP | 6.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|