C31H38O6 — CID 101436253
(E)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 101436253) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is (E)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101436253 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | (E)-3-[(8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc2c(cc1/C=C/C(=O)c1cc(OC)c(OC)c(OC)c1)[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C31H38O6/c1-31-13-12-21-22(24(31)9-11-29(31)33)8-6-18-15-26(34-2)19(14-23(18)21)7-10-25(32)20-16-27(35-3)30(37-5)28(17-20)36-4/h7,10,14-17,21-22,24,29,33H,6,8-9,11-13H2,1-5H3/b10-7+/t21-,22+,24-,29-,31-/m0/s1 |
| InChIKey | BSXOQZWOYJGSBT-XONMMQIXSA-N |
| XLogP | 5.83 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|