C29H36FN3O2 — CID 137355092
3-[(13S,15R,17E)-3-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-propan-2-yl-2-pyridinyl)propanamide (PubChem CID 137355092) has the molecular formula C29H36FN3O2 and a molecular weight of 477.62 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-3-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-propan-2-yl-2-pyridinyl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-3-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-propan-2-yl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 137355092 |
| Molecular Formula | C29H36FN3O2 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | 3-[(13S,15R,17E)-3-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-propan-2-yl-2-pyridinyl)propanamide |
| SMILES | CC(C)c1ccc(NC(=O)CCC2C/C(=N\O)[C@@]3(C)CCC4c5ccc(F)cc5CCC4C23)nc1 |
| InChI | InChI=1S/C29H36FN3O2/c1-17(2)20-5-10-26(31-16-20)32-27(34)11-6-19-15-25(33-35)29(3)13-12-23-22-9-7-21(30)14-18(22)4-8-24(23)28(19)29/h5,7,9-10,14,16-17,19,23-24,28,35H,4,6,8,11-13,15H2,1-3H3,(H,31,32,34)/b33-25+/t19?,23?,24?,28?,29-/m1/s1 |
| InChIKey | VKBSIXLLFWLWAA-UUMVIIPBSA-N |
| XLogP | 6.68 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|