C26H35FN2O3 — CID 137354696
3-[(13S,15R,17E)-4-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(oxan-4-yl)propanamide (PubChem CID 137354696) has the molecular formula C26H35FN2O3 and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-4-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(oxan-4-yl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-4-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 137354696 |
| Molecular Formula | C26H35FN2O3 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 3-[(13S,15R,17E)-4-fluoro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(oxan-4-yl)propanamide |
| SMILES | C[C@]12CCC3c4cccc(F)c4CCC3C1C(CCC(=O)NC1CCOCC1)C/C2=N\O |
| InChI | InChI=1S/C26H35FN2O3/c1-26-12-9-19-18-3-2-4-22(27)20(18)6-7-21(19)25(26)16(15-23(26)29-31)5-8-24(30)28-17-10-13-32-14-11-17/h2-4,16-17,19,21,25,31H,5-15H2,1H3,(H,28,30)/b29-23+/t16?,19?,21?,25?,26-/m1/s1 |
| InChIKey | RQGMACWBBHWXOZ-NILSNXMESA-N |
| XLogP | 4.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|