C25H31FN2O2S — CID 155187326
N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide (PubChem CID 155187326) has the molecular formula C25H31FN2O2S and a molecular weight of 442.60 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
|---|---|
| PubChem CID | 155187326 |
| Molecular Formula | C25H31FN2O2S |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
| SMILES | C[C@]12CCC3c4cccc(F)c4CCC3C1C(CCCC(=O)NC1=NCCS1)CC2=O |
| InChI | InChI=1S/C25H31FN2O2S/c1-25-11-10-17-16-5-3-6-20(26)18(16)8-9-19(17)23(25)15(14-21(25)29)4-2-7-22(30)28-24-27-12-13-31-24/h3,5-6,15,17,19,23H,2,4,7-14H2,1H3,(H,27,28,30)/t15?,17?,19?,23?,25-/m1/s1 |
| InChIKey | HLZYZGFKSCVAAA-FRLVOPKOSA-N |
| XLogP | 4.87 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |