C28H31FN2O4 — CID 156790141
3-[(13S,15S,16Z)-4-fluoro-16-(hydroxymethylidene)-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide (PubChem CID 156790141) has the molecular formula C28H31FN2O4 and a molecular weight of 478.56 g/mol. Its IUPAC name is 3-[(13S,15S,16Z)-4-fluoro-16-(hydroxymethylidene)-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide.
| Compound Name | 3-[(13S,15S,16Z)-4-fluoro-16-(hydroxymethylidene)-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 156790141 |
| Molecular Formula | C28H31FN2O4 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 3-[(13S,15S,16Z)-4-fluoro-16-(hydroxymethylidene)-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCC2/C(=C/O)C(=O)[C@@]3(C)CCC4c5cccc(F)c5CCC4C23)nc1 |
| InChI | InChI=1S/C28H31FN2O4/c1-28-13-12-18-17-4-3-5-23(29)19(17)7-8-20(18)26(28)21(22(15-32)27(28)34)9-11-25(33)31-24-10-6-16(35-2)14-30-24/h3-6,10,14-15,18,20-21,26,32H,7-9,11-13H2,1-2H3,(H,30,31,33)/b22-15-/t18?,20?,21?,26?,28-/m0/s1 |
| InChIKey | GKOGHHBJCXZUEE-SQBMRUDNSA-N |
| XLogP | 5.35 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|