C22H28FNO2 — CID 137354613
3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide (PubChem CID 137354613) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is 3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide.
| Compound Name | 3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 137354613 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide |
| SMILES | CNC(=O)CCC1CC(=O)[C@@]2(C)CCC3c4cccc(F)c4CCC3C12 |
| InChI | InChI=1S/C22H28FNO2/c1-22-11-10-15-14-4-3-5-18(23)16(14)7-8-17(15)21(22)13(12-19(22)25)6-9-20(26)24-2/h3-5,13,15,17,21H,6-12H2,1-2H3,(H,24,26)/t13?,15?,17?,21?,22-/m1/s1 |
| InChIKey | OCFYRRDUUCNGGL-MYBXWVEFSA-N |
| XLogP | 4.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |