C27H32N4O3S — CID 130316006
3-[(17E)-17-methoxyimino-18-methyl-6-oxa-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 130316006) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 3-[(17E)-17-methoxyimino-18-methyl-6-oxa-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(17E)-17-methoxyimino-18-methyl-6-oxa-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 130316006 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 3-[(17E)-17-methoxyimino-18-methyl-6-oxa-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CO/N=C1\CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4c(ccc5ocnc45)C3CCC12C |
| InChI | InChI=1S/C27H32N4O3S/c1-15-13-28-26(35-15)30-23(32)9-4-16-12-22(31-33-3)27(2)11-10-18-17-7-8-21-25(29-14-34-21)20(17)6-5-19(18)24(16)27/h7-8,13-14,16,18-19,24H,4-6,9-12H2,1-3H3,(H,28,30,32)/b31-22+ |
| InChIKey | QCVXCEOZHWZQFW-DFKUXCBWSA-N |
| XLogP | 6.10 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|