C26H32Br2N3O6PS — CID 121438575
[(13S,15R,17E)-2,4-dibromo-17-methoxyimino-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate (PubChem CID 121438575) has the molecular formula C26H32Br2N3O6PS and a molecular weight of 705.41 g/mol. Its IUPAC name is [(13S,15R,17E)-2,4-dibromo-17-methoxyimino-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate.
| Compound Name | [(13S,15R,17E)-2,4-dibromo-17-methoxyimino-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 121438575 |
| Molecular Formula | C26H32Br2N3O6PS |
| Molecular Weight | 705.41 g/mol |
| Exact Mass | 703.01 |
| IUPAC Name | [(13S,15R,17E)-2,4-dibromo-17-methoxyimino-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate |
| SMILES | CO/N=C1\CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4c(cc(Br)c(OP(=O)(O)O)c4Br)C3CC[C@]12C |
| InChI | InChI=1S/C26H32Br2N3O6PS/c1-13-12-29-25(39-13)30-21(32)7-4-14-10-20(31-36-3)26(2)9-8-15-16(22(14)26)5-6-17-18(15)11-19(27)24(23(17)28)37-38(33,34)35/h11-12,14-16,22H,4-10H2,1-3H3,(H,29,30,32)(H2,33,34,35)/b31-20+/t14?,15?,16?,22?,26-/m1/s1 |
| InChIKey | FKKOOVWPLRTDHG-VFTKEFFZSA-N |
| XLogP | 6.95 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.41 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|