C28H37N3O3S — CID 144765071
3-[(17E)-3-hydroxy-17-methoxyimino-2,4,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 144765071) has the molecular formula C28H37N3O3S and a molecular weight of 495.69 g/mol. Its IUPAC name is 3-[(17E)-3-hydroxy-17-methoxyimino-2,4,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(17E)-3-hydroxy-17-methoxyimino-2,4,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 144765071 |
| Molecular Formula | C28H37N3O3S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 3-[(17E)-3-hydroxy-17-methoxyimino-2,4,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CO/N=C1\CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4c(cc(C)c(O)c4C)C3CCC12C |
| InChI | InChI=1S/C28H37N3O3S/c1-15-12-22-19(17(3)26(15)33)7-8-21-20(22)10-11-28(4)23(31-34-5)13-18(25(21)28)6-9-24(32)30-27-29-14-16(2)35-27/h12,14,18,20-21,25,33H,6-11,13H2,1-5H3,(H,29,30,32)/b31-23+ |
| InChIKey | ZXMCIKFCHHVCJY-UQRQXUALSA-N |
| XLogP | 6.28 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|