C27H32N4O3S — CID 87055826
3-[(15R,17E,18S)-17-methoxyimino-18-methyl-7-oxa-5-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),5,9-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 87055826) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 3-[(15R,17E,18S)-17-methoxyimino-18-methyl-7-oxa-5-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),5,9-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(15R,17E,18S)-17-methoxyimino-18-methyl-7-oxa-5-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),5,9-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 87055826 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 3-[(15R,17E,18S)-17-methoxyimino-18-methyl-7-oxa-5-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),5,9-tetraen-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CO/N=C1\CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4cc5ocnc5cc4C3CC[C@]12C |
| InChI | InChI=1S/C27H32N4O3S/c1-15-13-28-26(35-15)30-24(32)7-5-17-11-23(31-33-3)27(2)9-8-18-19(25(17)27)6-4-16-10-22-21(12-20(16)18)29-14-34-22/h10,12-14,17-19,25H,4-9,11H2,1-3H3,(H,28,30,32)/b31-23+/t17?,18?,19?,25?,27-/m1/s1 |
| InChIKey | VHUTYZIDJHSZKU-RWIVJLMJSA-N |
| XLogP | 6.10 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|