C26H32ClN3O3S — CID 87055249
3-[(13S,15R,17E)-4-chloro-3-hydroxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 87055249) has the molecular formula C26H32ClN3O3S and a molecular weight of 502.08 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-4-chloro-3-hydroxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-4-chloro-3-hydroxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 87055249 |
| Molecular Formula | C26H32ClN3O3S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 3-[(13S,15R,17E)-4-chloro-3-hydroxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CO/N=C1\CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4c(ccc(O)c4Cl)C3CC[C@]12C |
| InChI | InChI=1S/C26H32ClN3O3S/c1-14-13-28-25(34-14)29-22(32)9-4-15-12-21(30-33-3)26(2)11-10-17-16-7-8-20(31)24(27)19(16)6-5-18(17)23(15)26/h7-8,13,15,17-18,23,31H,4-6,9-12H2,1-3H3,(H,28,29,32)/b30-21+/t15?,17?,18?,23?,26-/m1/s1 |
| InChIKey | FRRAICJRBQLARC-FYEIFVHRSA-N |
| XLogP | 6.31 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|