C25H31ClN4O2S — CID 172988751
3-[(13S,15R,17E)-4-chloro-17-hydrazinylidene-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 172988751) has the molecular formula C25H31ClN4O2S and a molecular weight of 487.07 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-4-chloro-17-hydrazinylidene-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-4-chloro-17-hydrazinylidene-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 172988751 |
| Molecular Formula | C25H31ClN4O2S |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[(13S,15R,17E)-4-chloro-17-hydrazinylidene-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2C/C(=N\N)[C@@]3(C)CCC4c5ccc(O)c(Cl)c5CCC4C23)s1 |
| InChI | InChI=1S/C25H31ClN4O2S/c1-13-12-28-24(33-13)29-21(32)8-3-14-11-20(30-27)25(2)10-9-16-15-6-7-19(31)23(26)18(15)5-4-17(16)22(14)25/h6-7,12,14,16-17,22,31H,3-5,8-11,27H2,1-2H3,(H,28,29,32)/b30-20+/t14?,16?,17?,22?,25-/m1/s1 |
| InChIKey | LNIUSPDQIQQINP-VFJYRUORSA-N |
| XLogP | 5.63 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|