C27H32FN3O2 — CID 154999171
N-(4-fluoro-2-pyridinyl)-4-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide (PubChem CID 154999171) has the molecular formula C27H32FN3O2 and a molecular weight of 449.57 g/mol. Its IUPAC name is N-(4-fluoro-2-pyridinyl)-4-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide.
| Compound Name | N-(4-fluoro-2-pyridinyl)-4-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
|---|---|
| PubChem CID | 154999171 |
| Molecular Formula | C27H32FN3O2 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N-(4-fluoro-2-pyridinyl)-4-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
| SMILES | C[C@]12CCC3c4ccccc4CCC3C1C(CCCC(=O)Nc1cc(F)ccn1)C/C2=N\O |
| InChI | InChI=1S/C27H32FN3O2/c1-27-13-11-21-20-7-3-2-5-17(20)9-10-22(21)26(27)18(15-23(27)31-33)6-4-8-25(32)30-24-16-19(28)12-14-29-24/h2-3,5,7,12,14,16,18,21-22,26,33H,4,6,8-11,13,15H2,1H3,(H,29,30,32)/b31-23+/t18?,21?,22?,26?,27-/m1/s1 |
| InChIKey | WUYOLJIDYFOELL-FIIJFBTMSA-N |
| XLogP | 5.94 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|