C27H35N3O2 — CID 174196314
(NE)-N-[(13S,15R)-15-[3-[(4-methoxy-2-pyridinyl)amino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]hydroxylamine (PubChem CID 174196314) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (NE)-N-[(13S,15R)-15-[3-[(4-methoxy-2-pyridinyl)amino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(13S,15R)-15-[3-[(4-methoxy-2-pyridinyl)amino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 174196314 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (NE)-N-[(13S,15R)-15-[3-[(4-methoxy-2-pyridinyl)amino]propyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]hydroxylamine |
| SMILES | COc1ccnc(NCCCC2C/C(=N\O)[C@@]3(C)CCC4c5ccccc5CCC4C23)c1 |
| InChI | InChI=1S/C27H35N3O2/c1-27-13-11-22-21-8-4-3-6-18(21)9-10-23(22)26(27)19(16-24(27)30-31)7-5-14-28-25-17-20(32-2)12-15-29-25/h3-4,6,8,12,15,17,19,22-23,26,31H,5,7,9-11,13-14,16H2,1-2H3,(H,28,29)/b30-24+/t19?,22?,23?,26?,27-/m1/s1 |
| InChIKey | MUODGILLGHNGSH-ASJFVAIZSA-N |
| XLogP | 5.89 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|