C26H31N3O3 — CID 137354966
3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(3-hydroxy-2-pyridinyl)propanamide (PubChem CID 137354966) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(3-hydroxy-2-pyridinyl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(3-hydroxy-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 137354966 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(3-hydroxy-2-pyridinyl)propanamide |
| SMILES | C[C@]12CCC3c4ccccc4CCC3C1C(CCC(=O)Nc1ncccc1O)C/C2=N\O |
| InChI | InChI=1S/C26H31N3O3/c1-26-13-12-19-18-6-3-2-5-16(18)8-10-20(19)24(26)17(15-22(26)29-32)9-11-23(31)28-25-21(30)7-4-14-27-25/h2-7,14,17,19-20,24,30,32H,8-13,15H2,1H3,(H,27,28,31)/b29-22+/t17?,19?,20?,24?,26-/m1/s1 |
| InChIKey | YWWLANNWSAWLTB-UXMBZZLQSA-N |
| XLogP | 5.12 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|