C30H37ClN4O3 — CID 137355329
3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide (PubChem CID 137355329) has the molecular formula C30H37ClN4O3 and a molecular weight of 537.10 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 137355329 |
| Molecular Formula | C30H37ClN4O3 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide |
| SMILES | C[C@]12CCC3c4ccc(Cl)cc4CCC3C1C(CCC(=O)Nc1ccc(N3CCOCC3)cn1)C/C2=N\O |
| InChI | InChI=1S/C30H37ClN4O3/c1-30-11-10-24-23-7-4-21(31)16-19(23)2-6-25(24)29(30)20(17-26(30)34-37)3-9-28(36)33-27-8-5-22(18-32-27)35-12-14-38-15-13-35/h4-5,7-8,16,18,20,24-25,29,37H,2-3,6,9-15,17H2,1H3,(H,32,33,36)/b34-26+/t20?,24?,25?,29?,30-/m1/s1 |
| InChIKey | KSVPWWWDWHXZED-VHALIRQXSA-N |
| XLogP | 5.90 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|