C36H46N2O3 — CID 143047582
5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-[3-(7-methyl-1H-indol-3-yl)propyl]pentanamide (PubChem CID 143047582) has the molecular formula C36H46N2O3 and a molecular weight of 554.78 g/mol. Its IUPAC name is 5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-[3-(7-methyl-1H-indol-3-yl)propyl]pentanamide.
| Compound Name | 5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-[3-(7-methyl-1H-indol-3-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 143047582 |
| Molecular Formula | C36H46N2O3 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | 5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-[3-(7-methyl-1H-indol-3-yl)propyl]pentanamide |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CC(CCCCC(=O)NCCCc3c[nH]c4c(C)cccc34)C12 |
| InChI | InChI=1S/C36H46N2O3/c1-23-8-6-11-29-26(22-38-35(23)29)10-7-19-37-33(40)12-5-4-9-25-21-32(39)36(2)18-17-30-28-16-14-27(41-3)20-24(28)13-15-31(30)34(25)36/h6,8,11,14,16,20,22,25,30-31,34,38H,4-5,7,9-10,12-13,15,17-19,21H2,1-3H3,(H,37,40) |
| InChIKey | GVKJMPOBPGQJKK-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|