C27H33BN2O4 — CID 69231902
[(13S,15R)-13-methyl-17-oxo-15-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 69231902) has the molecular formula C27H33BN2O4 and a molecular weight of 460.38 g/mol. Its IUPAC name is [(13S,15R)-13-methyl-17-oxo-15-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(13S,15R)-13-methyl-17-oxo-15-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 69231902 |
| Molecular Formula | C27H33BN2O4 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(13S,15R)-13-methyl-17-oxo-15-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | C[C@]12CCC3c4ccc(B(O)O)cc4CCC3C1C(CCC(=O)NCc1cccnc1)CC2=O |
| InChI | InChI=1S/C27H33BN2O4/c1-27-11-10-22-21-8-6-20(28(33)34)13-18(21)4-7-23(22)26(27)19(14-24(27)31)5-9-25(32)30-16-17-3-2-12-29-15-17/h2-3,6,8,12-13,15,19,22-23,26,33-34H,4-5,7,9-11,14,16H2,1H3,(H,30,32)/t19?,22?,23?,26?,27-/m1/s1 |
| InChIKey | KPGBCHCLZDRGIG-DDABJLHWSA-N |
| XLogP | 2.51 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|