C26H36BF2NO4 — CID 59822063
[(8R,9S,13S,14S,15S)-17,17-difluoro-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 59822063) has the molecular formula C26H36BF2NO4 and a molecular weight of 475.39 g/mol. Its IUPAC name is [(8R,9S,13S,14S,15S)-17,17-difluoro-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(8R,9S,13S,14S,15S)-17,17-difluoro-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 59822063 |
| Molecular Formula | C26H36BF2NO4 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [(8R,9S,13S,14S,15S)-17,17-difluoro-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(B(O)O)cc4CC[C@H]3[C@@H]1[C@@H](CCCC(=O)N1CCOCC1)CC2(F)F |
| InChI | InChI=1S/C26H36BF2NO4/c1-25-10-9-21-20-8-6-19(27(32)33)15-17(20)5-7-22(21)24(25)18(16-26(25,28)29)3-2-4-23(31)30-11-13-34-14-12-30/h6,8,15,18,21-22,24,32-33H,2-5,7,9-14,16H2,1H3/t18-,21+,22+,24-,25-/m0/s1 |
| InChIKey | JQWUDPYGKRUQOV-FRFGYBSGSA-N |
| XLogP | 3.11 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|