C36H47N3O6S — CID 24948685
(8R,9S,13S,14S,15S)-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-3-(3-morpholin-4-ylsulfonylanilino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 24948685) has the molecular formula C36H47N3O6S and a molecular weight of 649.85 g/mol. Its IUPAC name is (8R,9S,13S,14S,15S)-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-3-(3-morpholin-4-ylsulfonylanilino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15S)-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-3-(3-morpholin-4-ylsulfonylanilino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 24948685 |
| Molecular Formula | C36H47N3O6S |
| Molecular Weight | 649.85 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | (8R,9S,13S,14S,15S)-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-3-(3-morpholin-4-ylsulfonylanilino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(Nc5cccc(S(=O)(=O)N6CCOCC6)c5)cc4CC[C@H]3[C@@H]1[C@@H](CCCC(=O)N1CCOCC1)CC2=O |
| InChI | InChI=1S/C36H47N3O6S/c1-36-13-12-31-30-11-9-28(37-27-5-3-6-29(24-27)46(42,43)39-16-20-45-21-17-39)22-25(30)8-10-32(31)35(36)26(23-33(36)40)4-2-7-34(41)38-14-18-44-19-15-38/h3,5-6,9,11,22,24,26,31-32,35,37H,2,4,7-8,10,12-21,23H2,1H3/t26-,31+,32+,35-,36+/m0/s1 |
| InChIKey | VHMOEXOSFGUFMS-QJOPCUQZSA-N |
| XLogP | 5.13 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |