C29H39ClN2O3 — CID 137355042
3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-1-(8-oxa-2-azaspiro[4.5]decan-2-yl)propan-1-one (PubChem CID 137355042) has the molecular formula C29H39ClN2O3 and a molecular weight of 499.10 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-1-(8-oxa-2-azaspiro[4.5]decan-2-yl)propan-1-one.
| Compound Name | 3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-1-(8-oxa-2-azaspiro[4.5]decan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 137355042 |
| Molecular Formula | C29H39ClN2O3 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[(13S,15R,17E)-3-chloro-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-1-(8-oxa-2-azaspiro[4.5]decan-2-yl)propan-1-one |
| SMILES | C[C@]12CCC3c4ccc(Cl)cc4CCC3C1C(CCC(=O)N1CCC3(CCOCC3)C1)C/C2=N\O |
| InChI | InChI=1S/C29H39ClN2O3/c1-28-9-8-23-22-6-4-21(30)16-19(22)2-5-24(23)27(28)20(17-25(28)31-34)3-7-26(33)32-13-10-29(18-32)11-14-35-15-12-29/h4,6,16,20,23-24,27,34H,2-3,5,7-15,17-18H2,1H3/b31-25+/t20?,23?,24?,27?,28-/m1/s1 |
| InChIKey | UXOCTCWEUSYNJZ-ZXMDBQTJSA-N |
| XLogP | 6.06 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|