C26H34FNO3 — CID 66859764
4-[(13S,15S)-17-fluoro-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one (PubChem CID 66859764) has the molecular formula C26H34FNO3 and a molecular weight of 427.56 g/mol. Its IUPAC name is 4-[(13S,15S)-17-fluoro-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one.
| Compound Name | 4-[(13S,15S)-17-fluoro-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 66859764 |
| Molecular Formula | C26H34FNO3 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 4-[(13S,15S)-17-fluoro-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1C(CCCC(=O)N1CCOCC1)C=C2F |
| InChI | InChI=1S/C26H34FNO3/c1-26-10-9-21-20-8-6-19(29)15-17(20)5-7-22(21)25(26)18(16-23(26)27)3-2-4-24(30)28-11-13-31-14-12-28/h6,8,15-16,18,21-22,25,29H,2-5,7,9-14H2,1H3/t18?,21?,22?,25?,26-/m1/s1 |
| InChIKey | HRXJLLVTEBXJOB-VQAXRFOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |