C27H37NO5 — CID 15948917
(8R,9S,13S,14S,15R)-3-hydroxy-2-methoxy-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 15948917) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is (8R,9S,13S,14S,15R)-3-hydroxy-2-methoxy-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15R)-3-hydroxy-2-methoxy-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 15948917 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (8R,9S,13S,14S,15R)-3-hydroxy-2-methoxy-13-methyl-15-(4-morpholin-4-yl-4-oxobutyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1cc2c(cc1O)CC[C@H]1[C@@H]3[C@H](CCCC(=O)N4CCOCC4)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C27H37NO5/c1-27-9-8-19-20(7-6-17-14-22(29)23(32-2)16-21(17)19)26(27)18(15-24(27)30)4-3-5-25(31)28-10-12-33-13-11-28/h14,16,18-20,26,29H,3-13,15H2,1-2H3/t18-,19+,20-,26+,27-/m1/s1 |
| InChIKey | LHFOISNIKZNICH-JEOHVYTBSA-N |
| XLogP | 4.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |