C27H34F3NO3 — CID 58115420
4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one (PubChem CID 58115420) has the molecular formula C27H34F3NO3 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one.
| Compound Name | 4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 58115420 |
| Molecular Formula | C27H34F3NO3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]-1-morpholin-4-ylbutan-1-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1[C@H](CCCC(=O)N1CCOCC1)C=C2C(F)(F)F |
| InChI | InChI=1S/C27H34F3NO3/c1-26-10-9-21-20-8-6-19(32)15-17(20)5-7-22(21)25(26)18(16-23(26)27(28,29)30)3-2-4-24(33)31-11-13-34-14-12-31/h6,8,15-16,18,21-22,25,32H,2-5,7,9-14H2,1H3/t18-,21-,22-,25+,26-/m1/s1 |
| InChIKey | NIJVOHDAEVGIAI-OSKKXLQOSA-N |
| XLogP | 5.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|